About 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene
1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene (PubChem CID 19695394) has the molecular formula C17H21F5O
and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene |
| PubChem CID | 19695394 |
| Molecular Formula | C17H21F5O |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene |
| SMILES | FCC/C=C/C1CCC(C2(OC(F)(F)F)C=CCC=C2F)CC1 |
| InChI | InChI=1S/C17H21F5O/c18-12-4-2-5-13-7-9-14(10-8-13)16(23-17(20,21)22)11-3-1-6-15(16)19/h2-3,5-6,11,13-14H,1,4,7-10,12H2/b5-2+ |
| InChIKey | HXOOWMKPFDEBGT-GORDUTHDSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene?
The IUPAC name of 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene (CID 19695394) is 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene.
What is the SMILES notation for 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene?
The canonical SMILES for 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene is FCC/C=C/C1CCC(C2(OC(F)(F)F)C=CCC=C2F)CC1.
What is the InChIKey of 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene?
The InChIKey is HXOOWMKPFDEBGT-GORDUTHDSA-N. The full InChI is InChI=1S/C17H21F5O/c18-12-4-2-5-13-7-9-14(10-8-13)16(23-17(20,21)22)11-3-1-6-15(16)19/h2-3,5-6,11,13-14H,1,4,7-10,12H2/b5-2+.
What are the key properties of 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene?
1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene has a molecular weight of 336.34 g/mol, XLogP of 5.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]-6-(trifluoromethoxy)cyclohexa-1,4-diene is sourced from PubChem (CID 19695394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).