C17H16N4O7 — CID 19696187
8-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione (PubChem CID 19696187) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is 8-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione.
| Compound Name | 8-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19696187 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 8-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
| SMILES | Cc1o[nH]c(=O)c1CCOC1Cc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C17H16N4O7/c1-7-9(15(22)20-28-7)2-3-27-8-4-10-11(5-8)14-12(6-13(10)21(25)26)18-16(23)17(24)19-14/h6,8H,2-5H2,1H3,(H,18,23)(H,19,24)(H,20,22) |
| InChIKey | ZYNQNTHXSQGMKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|