C15H14N8O5 — CID 19696255
N-[(6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl)methyl]-2-(2H-tetrazol-5-yl)acetamide (PubChem CID 19696255) has the molecular formula C15H14N8O5 and a molecular weight of 386.33 g/mol. Its IUPAC name is N-[(6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl)methyl]-2-(2H-tetrazol-5-yl)acetamide.
| Compound Name | N-[(6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl)methyl]-2-(2H-tetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 19696255 |
| Molecular Formula | C15H14N8O5 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[(6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl)methyl]-2-(2H-tetrazol-5-yl)acetamide |
| SMILES | O=C(Cc1nn[nH]n1)NCC1Cc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C15H14N8O5/c24-12(4-11-19-21-22-20-11)16-5-6-1-7-8(2-6)13-9(3-10(7)23(27)28)17-14(25)15(26)18-13/h3,6H,1-2,4-5H2,(H,16,24)(H,17,25)(H,18,26)(H,19,20,21,22) |
| InChIKey | XOVBHSGSCSDDDQ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 192.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|