C18H18N4O7 — CID 19696271
9-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-1,4,7,8,9,10-hexahydrobenzo[f]quinoxaline-2,3-dione (PubChem CID 19696271) has the molecular formula C18H18N4O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is 9-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-1,4,7,8,9,10-hexahydrobenzo[f]quinoxaline-2,3-dione.
| Compound Name | 9-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-1,4,7,8,9,10-hexahydrobenzo[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19696271 |
| Molecular Formula | C18H18N4O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 9-[2-(5-methyl-3-oxo-1,2-oxazol-4-yl)ethoxy]-6-nitro-1,4,7,8,9,10-hexahydrobenzo[f]quinoxaline-2,3-dione |
| SMILES | Cc1o[nH]c(=O)c1CCOC1CCc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C18H18N4O7/c1-8-10(16(23)21-29-8)4-5-28-9-2-3-11-12(6-9)15-13(7-14(11)22(26)27)19-17(24)18(25)20-15/h7,9H,2-6H2,1H3,(H,19,24)(H,20,25)(H,21,23) |
| InChIKey | VECONPCGEKAOGG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|