C14H14N8O4 — CID 19696282
6-nitro-8-[(2H-tetrazol-5-ylmethylamino)methyl]-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione (PubChem CID 19696282) has the molecular formula C14H14N8O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is 6-nitro-8-[(2H-tetrazol-5-ylmethylamino)methyl]-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione.
| Compound Name | 6-nitro-8-[(2H-tetrazol-5-ylmethylamino)methyl]-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19696282 |
| Molecular Formula | C14H14N8O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-nitro-8-[(2H-tetrazol-5-ylmethylamino)methyl]-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c3c(c2[nH]c1=O)CC(CNCc1nn[nH]n1)C3 |
| InChI | InChI=1S/C14H14N8O4/c23-13-14(24)17-12-8-2-6(4-15-5-11-18-20-21-19-11)1-7(8)10(22(25)26)3-9(12)16-13/h3,6,15H,1-2,4-5H2,(H,16,23)(H,17,24)(H,18,19,20,21) |
| InChIKey | RPVUNHCDERDOMQ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 175.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|