C15H16N8O4 — CID 19696289
8-[[methyl(2H-tetrazol-5-ylmethyl)amino]methyl]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione (PubChem CID 19696289) has the molecular formula C15H16N8O4 and a molecular weight of 372.35 g/mol. Its IUPAC name is 8-[[methyl(2H-tetrazol-5-ylmethyl)amino]methyl]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione.
| Compound Name | 8-[[methyl(2H-tetrazol-5-ylmethyl)amino]methyl]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19696289 |
| Molecular Formula | C15H16N8O4 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 8-[[methyl(2H-tetrazol-5-ylmethyl)amino]methyl]-6-nitro-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
| SMILES | CN(Cc1nn[nH]n1)CC1Cc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C15H16N8O4/c1-22(6-12-18-20-21-19-12)5-7-2-8-9(3-7)13-10(4-11(8)23(26)27)16-14(24)15(25)17-13/h4,7H,2-3,5-6H2,1H3,(H,16,24)(H,17,25)(H,18,19,20,21) |
| InChIKey | OGSXIAYMWHOUDF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|