C28H22N6O3 — CID 19696310
3-[2-(imidazole-1-carbonyl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 19696310) has the molecular formula C28H22N6O3 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-[2-(imidazole-1-carbonyl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(imidazole-1-carbonyl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19696310 |
| Molecular Formula | C28H22N6O3 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 3-[2-(imidazole-1-carbonyl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCN(C(=O)n3ccnc3)C4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C28H22N6O3/c1-31-14-19(17-6-2-4-8-20(17)31)24-25(27(36)30-26(24)35)23-18-7-3-5-9-21(18)34-13-12-32(15-22(23)34)28(37)33-11-10-29-16-33/h2-11,14,16H,12-13,15H2,1H3,(H,30,35,36) |
| InChIKey | BBXVGRPVPQOWHY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|