C27H27ClN4O3 — CID 19696346
3-[8-(aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione;hydrochloride (PubChem CID 19696346) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 3-[8-(aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione;hydrochloride.
| Compound Name | 3-[8-(aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 19696346 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 3-[8-(aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione;hydrochloride |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c4n(c5ccccc35)CCC(CN)C4)C(=O)NC1=O)cn2C.Cl |
| InChI | InChI=1S/C27H26N4O3.ClH/c1-30-14-19(18-12-16(34-2)7-8-20(18)30)24-25(27(33)29-26(24)32)23-17-5-3-4-6-21(17)31-10-9-15(13-28)11-22(23)31;/h3-8,12,14-15H,9-11,13,28H2,1-2H3,(H,29,32,33);1H |
| InChIKey | MZVFKRJGJWGSPI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|