About 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one
1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one (PubChem CID 19696892) has the molecular formula C15H27O4P
and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one |
| PubChem CID | 19696892 |
| Molecular Formula | C15H27O4P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)P(=O)(C(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H27O4P/c1-13(2,3)10(16)20(19,11(17)14(4,5)6)12(18)15(7,8)9/h1-9H3 |
| InChIKey | AATRZHMYRLXNKH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one (CID 19696892) is 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)P(=O)(C(=O)C(C)(C)C)C(=O)C(C)(C)C.
What is the InChIKey of 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one?
The InChIKey is AATRZHMYRLXNKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27O4P/c1-13(2,3)10(16)20(19,11(17)14(4,5)6)12(18)15(7,8)9/h1-9H3.
What are the key properties of 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one?
1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one has a molecular weight of 302.35 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,2-dimethylpropanoyl)phosphoryl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 19696892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).