About 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+)
4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) (PubChem CID 19696964) has the molecular formula C19H30O3Ti
and a molecular weight of 354.31 g/mol. Its IUPAC name is 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+).
Molecular Properties
| Compound Name | 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) |
| PubChem CID | 19696964 |
| Molecular Formula | C19H30O3Ti |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].Cc1cccc2[cH-]ccc12.[Ti+4] |
| InChI | InChI=1S/C10H9.3C3H7O.Ti/c1-8-4-2-5-9-6-3-7-10(8)9;3*1-3(2)4;/h2-7H,1H3;3*3H,1-2H3;/q4*-1;+4 |
| InChIKey | DRIWPISYRMYPMG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+)?
The IUPAC name of 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) (CID 19696964) is 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+).
What is the SMILES notation for 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+)?
The canonical SMILES for 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) is CC(C)[O-].CC(C)[O-].CC(C)[O-].Cc1cccc2[cH-]ccc12.[Ti+4].
What is the InChIKey of 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+)?
The InChIKey is DRIWPISYRMYPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9.3C3H7O.Ti/c1-8-4-2-5-9-6-3-7-10(8)9;3*1-3(2)4;/h2-7H,1H3;3*3H,1-2H3;/q4*-1;+4.
What are the key properties of 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+)?
4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) has a molecular weight of 354.31 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-inden-1-ide;tris(propan-2-olate);titanium(4+) is sourced from PubChem (CID 19696964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).