C18H17NO2S — CID 19697333
6-methyl-N,N-diphenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 19697333) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 6-methyl-N,N-diphenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 6-methyl-N,N-diphenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 19697333 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-methyl-N,N-diphenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(c2ccccc2)c2ccccc2)SCCO1 |
| InChI | InChI=1S/C18H17NO2S/c1-14-17(22-13-12-21-14)18(20)19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3 |
| InChIKey | LQLJYXGYSWGXOG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |