About 8-chlorobenzo[d][2,3]benzoxazepine
8-chlorobenzo[d][2,3]benzoxazepine (PubChem CID 19697506) has the molecular formula C13H8ClNO
and a molecular weight of 229.67 g/mol. Its IUPAC name is 8-chlorobenzo[d][2,3]benzoxazepine.
Molecular Properties
| Compound Name | 8-chlorobenzo[d][2,3]benzoxazepine |
| PubChem CID | 19697506 |
| Molecular Formula | C13H8ClNO |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 8-chlorobenzo[d][2,3]benzoxazepine |
| SMILES | Clc1cccc2c1=CON=c1ccccc1=2 |
| InChI | InChI=1S/C13H8ClNO/c14-12-6-3-5-9-10-4-1-2-7-13(10)15-16-8-11(9)12/h1-8H |
| InChIKey | GPPCMBXKLBEABU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chlorobenzo[d][2,3]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorobenzo[d][2,3]benzoxazepine?
The IUPAC name of 8-chlorobenzo[d][2,3]benzoxazepine (CID 19697506) is 8-chlorobenzo[d][2,3]benzoxazepine.
What is the SMILES notation for 8-chlorobenzo[d][2,3]benzoxazepine?
The canonical SMILES for 8-chlorobenzo[d][2,3]benzoxazepine is Clc1cccc2c1=CON=c1ccccc1=2.
What is the InChIKey of 8-chlorobenzo[d][2,3]benzoxazepine?
The InChIKey is GPPCMBXKLBEABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO/c14-12-6-3-5-9-10-4-1-2-7-13(10)15-16-8-11(9)12/h1-8H.
What are the key properties of 8-chlorobenzo[d][2,3]benzoxazepine?
8-chlorobenzo[d][2,3]benzoxazepine has a molecular weight of 229.67 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorobenzo[d][2,3]benzoxazepine is sourced from PubChem (CID 19697506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).