About (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol
(1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol (PubChem CID 19697838) has the molecular formula C17H19NO
and a molecular weight of 253.35 g/mol. Its IUPAC name is (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol.
Molecular Properties
| Compound Name | (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol |
| PubChem CID | 19697838 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol |
| SMILES | OCC1Cc2ccccc2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H19NO/c19-13-15-10-16-8-4-5-9-17(16)18(12-15)11-14-6-2-1-3-7-14/h1-9,15,19H,10-13H2 |
| InChIKey | XLPXNTOFWRMLFM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol?
The IUPAC name of (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol (CID 19697838) is (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol.
What is the SMILES notation for (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol?
The canonical SMILES for (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol is OCC1Cc2ccccc2N(Cc2ccccc2)C1.
What is the InChIKey of (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol?
The InChIKey is XLPXNTOFWRMLFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c19-13-15-10-16-8-4-5-9-17(16)18(12-15)11-14-6-2-1-3-7-14/h1-9,15,19H,10-13H2.
What are the key properties of (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol?
(1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol has a molecular weight of 253.35 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,4-dihydro-2H-quinolin-3-yl)methanol is sourced from PubChem (CID 19697838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).