About ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate
ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate (PubChem CID 19698612) has the molecular formula C21H21NO5S
and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate |
| PubChem CID | 19698612 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1nc(-c2ccccc2)c(-c2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C21H21NO5S/c1-3-26-19(23)14-13-18-22-20(15-7-5-4-6-8-15)21(27-18)16-9-11-17(12-10-16)28(2,24)25/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | TVCUCMNRTOHEJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate?
The IUPAC name of ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate (CID 19698612) is ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate.
What is the SMILES notation for ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate?
The canonical SMILES for ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate is CCOC(=O)CCc1nc(-c2ccccc2)c(-c2ccc(S(C)(=O)=O)cc2)o1.
What is the InChIKey of ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate?
The InChIKey is TVCUCMNRTOHEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5S/c1-3-26-19(23)14-13-18-22-20(15-7-5-4-6-8-15)21(27-18)16-9-11-17(12-10-16)28(2,24)25/h4-12H,3,13-14H2,1-2H3.
What are the key properties of ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate?
ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate has a molecular weight of 399.47 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[5-(4-methylsulfonylphenyl)-4-phenyl-1,3-oxazol-2-yl]propanoate is sourced from PubChem (CID 19698612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).