C12H20Cl3N5 — CID 19698855
2,2,6,6-tetramethylpiperidin-4-amine;2,4,6-trichloro-1,3,5-triazine (PubChem CID 19698855) has the molecular formula C12H20Cl3N5 and a molecular weight of 340.69 g/mol. Its IUPAC name is 2,2,6,6-tetramethylpiperidin-4-amine;2,4,6-trichloro-1,3,5-triazine.
| Compound Name | 2,2,6,6-tetramethylpiperidin-4-amine;2,4,6-trichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 19698855 |
| Molecular Formula | C12H20Cl3N5 |
| Molecular Weight | 340.69 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2,2,6,6-tetramethylpiperidin-4-amine;2,4,6-trichloro-1,3,5-triazine |
| SMILES | CC1(C)CC(N)CC(C)(C)N1.Clc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H20N2.C3Cl3N3/c1-8(2)5-7(10)6-9(3,4)11-8;4-1-7-2(5)9-3(6)8-1/h7,11H,5-6,10H2,1-4H3; |
| InChIKey | CVTZWCNQTYGPEK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |