C17H20N2O9S — CID 19698925
1-[4-[2-(2,5-dioxopyrrol-1-yl)ethyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 19698925) has the molecular formula C17H20N2O9S and a molecular weight of 428.42 g/mol. Its IUPAC name is 1-[4-[2-(2,5-dioxopyrrol-1-yl)ethyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-[2-(2,5-dioxopyrrol-1-yl)ethyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 19698925 |
| Molecular Formula | C17H20N2O9S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-[4-[2-(2,5-dioxopyrrol-1-yl)ethyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(ON1C(=O)CC(S(=O)(=O)O)C1=O)C1CCC(CCN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C17H20N2O9S/c20-13-5-6-14(21)18(13)8-7-10-1-3-11(4-2-10)17(24)28-19-15(22)9-12(16(19)23)29(25,26)27/h5-6,10-12H,1-4,7-9H2,(H,25,26,27) |
| InChIKey | FCBMBIMEELDFTR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|