About N,N-diethylcyclohexa-1,3-diene-1-carboxamide
N,N-diethylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 19699028) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N,N-diethylcyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N,N-diethylcyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 19699028 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-diethylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C11H17NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | JDWUJORQASPBMN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylcyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylcyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of N,N-diethylcyclohexa-1,3-diene-1-carboxamide (CID 19699028) is N,N-diethylcyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for N,N-diethylcyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for N,N-diethylcyclohexa-1,3-diene-1-carboxamide is CCN(CC)C(=O)C1=CC=CCC1.
What is the InChIKey of N,N-diethylcyclohexa-1,3-diene-1-carboxamide?
The InChIKey is JDWUJORQASPBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-6,8H,3-4,7,9H2,1-2H3.
What are the key properties of N,N-diethylcyclohexa-1,3-diene-1-carboxamide?
N,N-diethylcyclohexa-1,3-diene-1-carboxamide has a molecular weight of 179.26 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylcyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 19699028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).