About 6H-quinolin-2-one
6H-quinolin-2-one (PubChem CID 19699059) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 6H-quinolin-2-one.
Molecular Properties
| Compound Name | 6H-quinolin-2-one |
| PubChem CID | 19699059 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 6H-quinolin-2-one |
| SMILES | O=C1C=CC2=CCC=CC2=N1 |
| InChI | InChI=1S/C9H7NO/c11-9-6-5-7-3-1-2-4-8(7)10-9/h2-6H,1H2 |
| InChIKey | VVNLIZOGBDPODZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-quinolin-2-one?
The IUPAC name of 6H-quinolin-2-one (CID 19699059) is 6H-quinolin-2-one.
What is the SMILES notation for 6H-quinolin-2-one?
The canonical SMILES for 6H-quinolin-2-one is O=C1C=CC2=CCC=CC2=N1.
What is the InChIKey of 6H-quinolin-2-one?
The InChIKey is VVNLIZOGBDPODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-9-6-5-7-3-1-2-4-8(7)10-9/h2-6H,1H2.
What are the key properties of 6H-quinolin-2-one?
6H-quinolin-2-one has a molecular weight of 145.16 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-quinolin-2-one is sourced from PubChem (CID 19699059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).