C24H26N4O2S — CID 19699114
N-[4-(4-methyl-13-thia-3,4,9-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene-9-carbonyl)phenyl]cyclohexanecarboxamide (PubChem CID 19699114) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[4-(4-methyl-13-thia-3,4,9-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene-9-carbonyl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(4-methyl-13-thia-3,4,9-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene-9-carbonyl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 19699114 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[4-(4-methyl-13-thia-3,4,9-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene-9-carbonyl)phenyl]cyclohexanecarboxamide |
| SMILES | Cn1cc2c(n1)-c1sccc1N(C(=O)c1ccc(NC(=O)C3CCCCC3)cc1)CC2 |
| InChI | InChI=1S/C24H26N4O2S/c1-27-15-18-11-13-28(20-12-14-31-22(20)21(18)26-27)24(30)17-7-9-19(10-8-17)25-23(29)16-5-3-2-4-6-16/h7-10,12,14-16H,2-6,11,13H2,1H3,(H,25,29) |
| InChIKey | MATNAGUVHYFKBR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |