C10H8N4 — CID 19699118
3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1,3,5,9,11,13-hexaene (PubChem CID 19699118) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1,3,5,9,11,13-hexaene.
| Compound Name | 3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1,3,5,9,11,13-hexaene |
|---|---|
| PubChem CID | 19699118 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1,3,5,9,11,13-hexaene |
| SMILES | C1=C2CCN=c3ncccc3=C2N=N1 |
| InChI | InChI=1S/C10H8N4/c1-2-8-9-7(6-13-14-9)3-5-12-10(8)11-4-1/h1-2,4,6H,3,5H2 |
| InChIKey | CJWWDTJDPQUNTI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |