C20H19N3O2S — CID 19699341
5-[[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 19699341) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 5-[[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19699341 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 5-[[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2ccn(C3CCc4ccccc4C3)c2=S)cn1 |
| InChI | InChI=1S/C20H19N3O2S/c24-19(25)18-8-5-14(12-21-18)13-22-9-10-23(20(22)26)17-7-6-15-3-1-2-4-16(15)11-17/h1-5,8-10,12,17H,6-7,11,13H2,(H,24,25) |
| InChIKey | MRIZEIBBCSCMDP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|