About tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate
tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 19699347) has the molecular formula C12H23N3O4
and a molecular weight of 273.33 g/mol. Its IUPAC name is tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| PubChem CID | 19699347 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | C/N=C(\N)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-11(2,3)18-9(16)15(8(13)14-7)10(17)19-12(4,5)6/h1-7H3,(H2,13,14) |
| InChIKey | VXFJRDONXHJECU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The IUPAC name of tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CID 19699347) is tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
What is the SMILES notation for tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The canonical SMILES for tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is C/N=C(\N)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The InChIKey is VXFJRDONXHJECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O4/c1-11(2,3)18-9(16)15(8(13)14-7)10(17)19-12(4,5)6/h1-7H3,(H2,13,14).
What are the key properties of tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate has a molecular weight of 273.33 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(N'-methylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is sourced from PubChem (CID 19699347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).