C15H17F2NO3 — CID 19699354
ethyl 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate (PubChem CID 19699354) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is ethyl 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate.
| Compound Name | ethyl 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate |
|---|---|
| PubChem CID | 19699354 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate |
| SMILES | CCOC(=O)CN(C=O)C1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C15H17F2NO3/c1-2-21-15(20)8-18(9-19)12-3-4-13-10(6-12)5-11(16)7-14(13)17/h5,7,9,12H,2-4,6,8H2,1H3 |
| InChIKey | VEESUDNZQHPDOY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|