C14H17ClFN3S — CID 19699388
4-(aminomethyl)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-1H-imidazole-2-thione;hydrochloride (PubChem CID 19699388) has the molecular formula C14H17ClFN3S and a molecular weight of 313.83 g/mol. Its IUPAC name is 4-(aminomethyl)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-1H-imidazole-2-thione;hydrochloride.
| Compound Name | 4-(aminomethyl)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-1H-imidazole-2-thione;hydrochloride |
|---|---|
| PubChem CID | 19699388 |
| Molecular Formula | C14H17ClFN3S |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-(aminomethyl)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-1H-imidazole-2-thione;hydrochloride |
| SMILES | Cl.NCc1c[nH]c(=S)n1C1CCc2c(F)cccc2C1 |
| InChI | InChI=1S/C14H16FN3S.ClH/c15-13-3-1-2-9-6-10(4-5-12(9)13)18-11(7-16)8-17-14(18)19;/h1-3,8,10H,4-7,16H2,(H,17,19);1H |
| InChIKey | FASZPSDLIYAEPD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|