C15H16N4 — CID 19700623
N-(1,2,4,5-tetrahydro-1,5-benzodiazepin-3-ylideneamino)aniline (PubChem CID 19700623) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(1,2,4,5-tetrahydro-1,5-benzodiazepin-3-ylideneamino)aniline.
| Compound Name | N-(1,2,4,5-tetrahydro-1,5-benzodiazepin-3-ylideneamino)aniline |
|---|---|
| PubChem CID | 19700623 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-(1,2,4,5-tetrahydro-1,5-benzodiazepin-3-ylideneamino)aniline |
| SMILES | c1ccc(NN=C2CNc3ccccc3NC2)cc1 |
| InChI | InChI=1S/C15H16N4/c1-2-6-12(7-3-1)18-19-13-10-16-14-8-4-5-9-15(14)17-11-13/h1-9,16-18H,10-11H2 |
| InChIKey | ROQLPLMOKWGPJW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|