C29H39N5O3 — CID 19700643
1-[5-(cyclohexylmethyl)-1-[2-(diethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 19700643) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is 1-[5-(cyclohexylmethyl)-1-[2-(diethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[5-(cyclohexylmethyl)-1-[2-(diethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 19700643 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 1-[5-(cyclohexylmethyl)-1-[2-(diethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | CCN(CC)CCN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(CC2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C29H39N5O3/c1-3-32(4-2)19-20-33-24-17-11-12-18-25(24)34(21-22-13-7-5-8-14-22)28(36)26(27(33)35)31-29(37)30-23-15-9-6-10-16-23/h6,9-12,15-18,22,26H,3-5,7-8,13-14,19-21H2,1-2H3,(H2,30,31,37) |
| InChIKey | MUEYPSOUIYJFDW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|