About 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one
8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one (PubChem CID 19700747) has the molecular formula C17H15N3O3
and a molecular weight of 309.33 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one.
Molecular Properties
| Compound Name | 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one |
| PubChem CID | 19700747 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one |
| SMILES | CC(C)n1nc(-c2ccc3c(c2)OCO3)c2ncccc2c1=O |
| InChI | InChI=1S/C17H15N3O3/c1-10(2)20-17(21)12-4-3-7-18-16(12)15(19-20)11-5-6-13-14(8-11)23-9-22-13/h3-8,10H,9H2,1-2H3 |
| InChIKey | WHSKTUKXESFSFT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one?
The IUPAC name of 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one (CID 19700747) is 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one.
What is the SMILES notation for 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one?
The canonical SMILES for 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one is CC(C)n1nc(-c2ccc3c(c2)OCO3)c2ncccc2c1=O.
What is the InChIKey of 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one?
The InChIKey is WHSKTUKXESFSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3/c1-10(2)20-17(21)12-4-3-7-18-16(12)15(19-20)11-5-6-13-14(8-11)23-9-22-13/h3-8,10H,9H2,1-2H3.
What are the key properties of 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one?
8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one has a molecular weight of 309.33 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-benzodioxol-5-yl)-6-propan-2-ylpyrido[2,3-d]pyridazin-5-one is sourced from PubChem (CID 19700747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).