About imidazo[1,2-a]pyridine-2,7-dicarboxylic acid
imidazo[1,2-a]pyridine-2,7-dicarboxylic acid (PubChem CID 19701499) has the molecular formula C9H6N2O4
and a molecular weight of 206.16 g/mol. Its IUPAC name is imidazo[1,2-a]pyridine-2,7-dicarboxylic acid.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridine-2,7-dicarboxylic acid |
| PubChem CID | 19701499 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | imidazo[1,2-a]pyridine-2,7-dicarboxylic acid |
| SMILES | O=C(O)c1ccn2cc(C(=O)O)nc2c1 |
| InChI | InChI=1S/C9H6N2O4/c12-8(13)5-1-2-11-4-6(9(14)15)10-7(11)3-5/h1-4H,(H,12,13)(H,14,15) |
| InChIKey | QSCBTXSRXOGDOH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[1,2-a]pyridine-2,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridine-2,7-dicarboxylic acid?
The IUPAC name of imidazo[1,2-a]pyridine-2,7-dicarboxylic acid (CID 19701499) is imidazo[1,2-a]pyridine-2,7-dicarboxylic acid.
What is the SMILES notation for imidazo[1,2-a]pyridine-2,7-dicarboxylic acid?
The canonical SMILES for imidazo[1,2-a]pyridine-2,7-dicarboxylic acid is O=C(O)c1ccn2cc(C(=O)O)nc2c1.
What is the InChIKey of imidazo[1,2-a]pyridine-2,7-dicarboxylic acid?
The InChIKey is QSCBTXSRXOGDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4/c12-8(13)5-1-2-11-4-6(9(14)15)10-7(11)3-5/h1-4H,(H,12,13)(H,14,15).
What are the key properties of imidazo[1,2-a]pyridine-2,7-dicarboxylic acid?
imidazo[1,2-a]pyridine-2,7-dicarboxylic acid has a molecular weight of 206.16 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridine-2,7-dicarboxylic acid is sourced from PubChem (CID 19701499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).