About 6-methyl-1,4-dioxacycloheptadecane-5,17-dione
6-methyl-1,4-dioxacycloheptadecane-5,17-dione (PubChem CID 19702284) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-methyl-1,4-dioxacycloheptadecane-5,17-dione.
Molecular Properties
| Compound Name | 6-methyl-1,4-dioxacycloheptadecane-5,17-dione |
| PubChem CID | 19702284 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 6-methyl-1,4-dioxacycloheptadecane-5,17-dione |
| SMILES | CC1CCCCCCCCCCC(=O)OCCOC1=O |
| InChI | InChI=1S/C16H28O4/c1-14-10-8-6-4-2-3-5-7-9-11-15(17)19-12-13-20-16(14)18/h14H,2-13H2,1H3 |
| InChIKey | TVRMCBYUTDCMIY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,4-dioxacycloheptadecane-5,17-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-dioxacycloheptadecane-5,17-dione?
The IUPAC name of 6-methyl-1,4-dioxacycloheptadecane-5,17-dione (CID 19702284) is 6-methyl-1,4-dioxacycloheptadecane-5,17-dione.
What is the SMILES notation for 6-methyl-1,4-dioxacycloheptadecane-5,17-dione?
The canonical SMILES for 6-methyl-1,4-dioxacycloheptadecane-5,17-dione is CC1CCCCCCCCCCC(=O)OCCOC1=O.
What is the InChIKey of 6-methyl-1,4-dioxacycloheptadecane-5,17-dione?
The InChIKey is TVRMCBYUTDCMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-14-10-8-6-4-2-3-5-7-9-11-15(17)19-12-13-20-16(14)18/h14H,2-13H2,1H3.
What are the key properties of 6-methyl-1,4-dioxacycloheptadecane-5,17-dione?
6-methyl-1,4-dioxacycloheptadecane-5,17-dione has a molecular weight of 284.40 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-dioxacycloheptadecane-5,17-dione is sourced from PubChem (CID 19702284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).