C10H24O4Si4 — CID 19702669
2,2-bis(ethenyl)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 19702669) has the molecular formula C10H24O4Si4 and a molecular weight of 320.64 g/mol. Its IUPAC name is 2,2-bis(ethenyl)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2-bis(ethenyl)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 19702669 |
| Molecular Formula | C10H24O4Si4 |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2,2-bis(ethenyl)-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C=C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H24O4Si4/c1-9-18(10-2)13-16(5,6)11-15(3,4)12-17(7,8)14-18/h9-10H,1-2H2,3-8H3 |
| InChIKey | JCPAUZNZVFBPMD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|