C12H12F3N3O2 — CID 19702787
(2Z)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-(4-methylpyrimidin-5-yl)butane-1,3-dione (PubChem CID 19702787) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is (2Z)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-(4-methylpyrimidin-5-yl)butane-1,3-dione.
| Compound Name | (2Z)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-(4-methylpyrimidin-5-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 19702787 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (2Z)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-(4-methylpyrimidin-5-yl)butane-1,3-dione |
| SMILES | Cc1ncncc1C(=O)/C(=C/N(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O2/c1-7-8(4-16-6-17-7)10(19)9(5-18(2)3)11(20)12(13,14)15/h4-6H,1-3H3/b9-5- |
| InChIKey | GZFAFJXBLGOTKW-UITAMQMPSA-N |
| XLogP | 1.54 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|