About 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine
3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine (PubChem CID 19703011) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine |
| PubChem CID | 19703011 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine |
| SMILES | COc1nccc2c(CBr)coc12 |
| InChI | InChI=1S/C9H8BrNO2/c1-12-9-8-7(2-3-11-9)6(4-10)5-13-8/h2-3,5H,4H2,1H3 |
| InChIKey | LZTICJAXGGFUCH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine?
The IUPAC name of 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine (CID 19703011) is 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine.
What is the SMILES notation for 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine?
The canonical SMILES for 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine is COc1nccc2c(CBr)coc12.
What is the InChIKey of 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine?
The InChIKey is LZTICJAXGGFUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c1-12-9-8-7(2-3-11-9)6(4-10)5-13-8/h2-3,5H,4H2,1H3.
What are the key properties of 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine?
3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine has a molecular weight of 242.07 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-7-methoxyfuro[2,3-c]pyridine is sourced from PubChem (CID 19703011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).