About N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide
N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide (PubChem CID 19703015) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide |
| PubChem CID | 19703015 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2occ(CCNC(C)=O)c2n1 |
| InChI | InChI=1S/C12H14N2O3/c1-8(15)13-6-5-9-7-17-10-3-4-11(16-2)14-12(9)10/h3-4,7H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | LYZYGPCQJXQOQO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide?
The IUPAC name of N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide (CID 19703015) is N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide is COc1ccc2occ(CCNC(C)=O)c2n1.
What is the InChIKey of N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide?
The InChIKey is LYZYGPCQJXQOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-8(15)13-6-5-9-7-17-10-3-4-11(16-2)14-12(9)10/h3-4,7H,5-6H2,1-2H3,(H,13,15).
What are the key properties of N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide?
N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide has a molecular weight of 234.25 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-methoxyfuro[3,2-b]pyridin-3-yl)ethyl]acetamide is sourced from PubChem (CID 19703015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).