About tert-butyl N-(3-bromo-2-pyridinyl)carbamate
tert-butyl N-(3-bromo-2-pyridinyl)carbamate (PubChem CID 19704035) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-2-pyridinyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(3-bromo-2-pyridinyl)carbamate |
| PubChem CID | 19704035 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | tert-butyl N-(3-bromo-2-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncccc1Br |
| InChI | InChI=1S/C10H13BrN2O2/c1-10(2,3)15-9(14)13-8-7(11)5-4-6-12-8/h4-6H,1-3H3,(H,12,13,14) |
| InChIKey | QYXWTADXOAAMPA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(3-bromo-2-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-bromo-2-pyridinyl)carbamate?
The IUPAC name of tert-butyl N-(3-bromo-2-pyridinyl)carbamate (CID 19704035) is tert-butyl N-(3-bromo-2-pyridinyl)carbamate.
What is the SMILES notation for tert-butyl N-(3-bromo-2-pyridinyl)carbamate?
The canonical SMILES for tert-butyl N-(3-bromo-2-pyridinyl)carbamate is CC(C)(C)OC(=O)Nc1ncccc1Br.
What is the InChIKey of tert-butyl N-(3-bromo-2-pyridinyl)carbamate?
The InChIKey is QYXWTADXOAAMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c1-10(2,3)15-9(14)13-8-7(11)5-4-6-12-8/h4-6H,1-3H3,(H,12,13,14).
What are the key properties of tert-butyl N-(3-bromo-2-pyridinyl)carbamate?
tert-butyl N-(3-bromo-2-pyridinyl)carbamate has a molecular weight of 273.13 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-bromo-2-pyridinyl)carbamate is sourced from PubChem (CID 19704035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).