About 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride
2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride (PubChem CID 19704266) has the molecular formula C6H10ClF2NO2
and a molecular weight of 201.60 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride |
| PubChem CID | 19704266 |
| Molecular Formula | C6H10ClF2NO2 |
| Molecular Weight | 201.60 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CNCCC=C(F)F |
| InChI | InChI=1S/C6H9F2NO2.ClH/c7-5(8)2-1-3-9-4-6(10)11;/h2,9H,1,3-4H2,(H,10,11);1H |
| InChIKey | YHUBZPRRXAHZQN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.60 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride?
The IUPAC name of 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride (CID 19704266) is 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride.
What is the SMILES notation for 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride?
The canonical SMILES for 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride is Cl.O=C(O)CNCCC=C(F)F.
What is the InChIKey of 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride?
The InChIKey is YHUBZPRRXAHZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO2.ClH/c7-5(8)2-1-3-9-4-6(10)11;/h2,9H,1,3-4H2,(H,10,11);1H.
What are the key properties of 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride?
2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride has a molecular weight of 201.60 g/mol, XLogP of 1.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorobut-3-enylamino)acetic acid;hydrochloride is sourced from PubChem (CID 19704266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).