About 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine
5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine (PubChem CID 19705095) has the molecular formula C17H14Cl2N4O
and a molecular weight of 361.23 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine |
| PubChem CID | 19705095 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c(-c2cccc(Cl)c2Cl)c(COc2ccccc2)n1 |
| InChI | InChI=1S/C17H14Cl2N4O/c18-12-8-4-7-11(15(12)19)14-13(22-17(21)23-16(14)20)9-24-10-5-2-1-3-6-10/h1-8H,9H2,(H4,20,21,22,23) |
| InChIKey | HMHHXFXZVHBYGC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine (CID 19705095) is 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine is Nc1nc(N)c(-c2cccc(Cl)c2Cl)c(COc2ccccc2)n1.
What is the InChIKey of 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine?
The InChIKey is HMHHXFXZVHBYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N4O/c18-12-8-4-7-11(15(12)19)14-13(22-17(21)23-16(14)20)9-24-10-5-2-1-3-6-10/h1-8H,9H2,(H4,20,21,22,23).
What are the key properties of 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine?
5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine has a molecular weight of 361.23 g/mol, XLogP of 4.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dichlorophenyl)-6-(phenoxymethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 19705095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).