C10H3Cl3F3NO — CID 19705109
4,4,4-trifluoro-3-oxo-2-(2,3,5-trichlorophenyl)butanenitrile (PubChem CID 19705109) has the molecular formula C10H3Cl3F3NO and a molecular weight of 316.49 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-oxo-2-(2,3,5-trichlorophenyl)butanenitrile.
| Compound Name | 4,4,4-trifluoro-3-oxo-2-(2,3,5-trichlorophenyl)butanenitrile |
|---|---|
| PubChem CID | 19705109 |
| Molecular Formula | C10H3Cl3F3NO |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | 4,4,4-trifluoro-3-oxo-2-(2,3,5-trichlorophenyl)butanenitrile |
| SMILES | N#CC(C(=O)C(F)(F)F)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H3Cl3F3NO/c11-4-1-5(8(13)7(12)2-4)6(3-17)9(18)10(14,15)16/h1-2,6H |
| InChIKey | KAZSERADNVUUNY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|