C37H37F3N4O2 — CID 19705141
4-phenyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 19705141) has the molecular formula C37H37F3N4O2 and a molecular weight of 626.72 g/mol. Its IUPAC name is 4-phenyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | 4-phenyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19705141 |
| Molecular Formula | C37H37F3N4O2 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 4-phenyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C37H37F3N4O2/c38-37(39,40)25-42-35(46)36(31-14-6-4-12-29(31)30-13-5-7-15-32(30)36)19-8-9-21-44-22-17-28(18-23-44)43-34(45)33-24-27(16-20-41-33)26-10-2-1-3-11-26/h1-7,10-16,20,24,28H,8-9,17-19,21-23,25H2,(H,42,46)(H,43,45) |
| InChIKey | UUSZOJNQSOUPCC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|