C31H32ClF3N4O2 — CID 19705151
4-chloro-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 19705151) has the molecular formula C31H32ClF3N4O2 and a molecular weight of 585.07 g/mol. Its IUPAC name is 4-chloro-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19705151 |
| Molecular Formula | C31H32ClF3N4O2 |
| Molecular Weight | 585.07 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 4-chloro-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1cnccc1Cl |
| InChI | InChI=1S/C31H32ClF3N4O2/c32-27-11-15-36-19-24(27)28(40)38-21-12-17-39(18-13-21)16-6-5-14-30(29(41)37-20-31(33,34)35)25-9-3-1-7-22(25)23-8-2-4-10-26(23)30/h1-4,7-11,15,19,21H,5-6,12-14,16-18,20H2,(H,37,41)(H,38,40) |
| InChIKey | XRIMCYVSHMBPOA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.07 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|