About 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole
3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole (PubChem CID 19705379) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole.
Analyze 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole?
The IUPAC name of 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole (CID 19705379) is 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole?
The canonical SMILES for 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole is C1=C(c2cnsn2)CNCC1.
What is the InChIKey of 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole?
The InChIKey is NXCOVGCKVJBPTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-2-6(4-8-3-1)7-5-9-11-10-7/h2,5,8H,1,3-4H2.
What are the key properties of 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole?
3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole has a molecular weight of 167.24 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole is sourced from PubChem (CID 19705379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).