C26H8AlF20N — CID 19705667
dimethylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide (PubChem CID 19705667) has the molecular formula C26H8AlF20N and a molecular weight of 741.30 g/mol. Its IUPAC name is dimethylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide.
| Compound Name | dimethylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide |
|---|---|
| PubChem CID | 19705667 |
| Molecular Formula | C26H8AlF20N |
| Molecular Weight | 741.30 g/mol |
| Exact Mass | 741.02 |
| IUPAC Name | dimethylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide |
| SMILES | C[NH2+]C.Fc1c(F)c(F)c([Al-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/4C6F5.C2H7N.Al/c4*7-2-1-3(8)5(10)6(11)4(2)9;1-3-2;/h;;;;3H,1-2H3;/q;;;;;-1/p+1 |
| InChIKey | QRMYBVONQUEUDU-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|