C23H42O3Si — CID 19705947
(4E,8E)-3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid (PubChem CID 19705947) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is (4E,8E)-3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid.
| Compound Name | (4E,8E)-3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid |
|---|---|
| PubChem CID | 19705947 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (4E,8E)-3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O3Si/c1-18(2)12-10-13-19(3)14-11-15-20(4)16-21(17-22(24)25)26-27(8,9)23(5,6)7/h12,14,16,21H,10-11,13,15,17H2,1-9H3,(H,24,25)/b19-14+,20-16+ |
| InChIKey | DDRQOYSMWRFOBI-XHGFWWIISA-N |
| XLogP | 7.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|