About 2-cyclooctylazocane
2-cyclooctylazocane (PubChem CID 19706164) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 2-cyclooctylazocane.
Molecular Properties
| Compound Name | 2-cyclooctylazocane |
| PubChem CID | 19706164 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2-cyclooctylazocane |
| SMILES | C1CCCC(C2CCCCCCN2)CCC1 |
| InChI | InChI=1S/C15H29N/c1-2-6-10-14(11-7-3-1)15-12-8-4-5-9-13-16-15/h14-16H,1-13H2 |
| InChIKey | FVHVJARLLUJUTI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclooctylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclooctylazocane?
The IUPAC name of 2-cyclooctylazocane (CID 19706164) is 2-cyclooctylazocane.
What is the SMILES notation for 2-cyclooctylazocane?
The canonical SMILES for 2-cyclooctylazocane is C1CCCC(C2CCCCCCN2)CCC1.
What is the InChIKey of 2-cyclooctylazocane?
The InChIKey is FVHVJARLLUJUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-2-6-10-14(11-7-3-1)15-12-8-4-5-9-13-16-15/h14-16H,1-13H2.
What are the key properties of 2-cyclooctylazocane?
2-cyclooctylazocane has a molecular weight of 223.40 g/mol, XLogP of 4.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclooctylazocane is sourced from PubChem (CID 19706164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).