C8H12N2O8 — CID 19706256
N,N'-bis(2,2,2-trihydroxyethyl)but-2-ynediamide (PubChem CID 19706256) has the molecular formula C8H12N2O8 and a molecular weight of 264.19 g/mol. Its IUPAC name is N,N'-bis(2,2,2-trihydroxyethyl)but-2-ynediamide.
| Compound Name | N,N'-bis(2,2,2-trihydroxyethyl)but-2-ynediamide |
|---|---|
| PubChem CID | 19706256 |
| Molecular Formula | C8H12N2O8 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N,N'-bis(2,2,2-trihydroxyethyl)but-2-ynediamide |
| SMILES | O=C(C#CC(=O)NCC(O)(O)O)NCC(O)(O)O |
| InChI | InChI=1S/C8H12N2O8/c11-5(9-3-7(13,14)15)1-2-6(12)10-4-8(16,17)18/h13-18H,3-4H2,(H,9,11)(H,10,12) |
| InChIKey | GCKYEJBQYZOLOX-UHFFFAOYSA-N |
| XLogP | -5.52 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|