C20H15N3O7S — CID 19706964
(5Z)-5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 19706964) has the molecular formula C20H15N3O7S and a molecular weight of 441.42 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 19706964 |
| Molecular Formula | C20H15N3O7S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (5Z)-5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCCN3COc4ccc([N+](=O)[O-])cc4C3=O)cc2)S1 |
| InChI | InChI=1S/C20H15N3O7S/c24-18-17(31-20(26)21-18)9-12-1-4-14(5-2-12)29-8-7-22-11-30-16-6-3-13(23(27)28)10-15(16)19(22)25/h1-6,9-10H,7-8,11H2,(H,21,24,26)/b17-9- |
| InChIKey | ATZOFPVLIQCLCI-MFOYZWKCSA-N |
| XLogP | 2.79 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|