C20H17N3O6S2 — CID 19706991
5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzothiazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 19706991) has the molecular formula C20H17N3O6S2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzothiazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzothiazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 19706991 |
| Molecular Formula | C20H17N3O6S2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 5-[[4-[2-(6-nitro-4-oxo-2H-1,3-benzothiazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCN3CSc4ccc([N+](=O)[O-])cc4C3=O)cc2)S1 |
| InChI | InChI=1S/C20H17N3O6S2/c24-18-17(31-20(26)21-18)9-12-1-4-14(5-2-12)29-8-7-22-11-30-16-6-3-13(23(27)28)10-15(16)19(22)25/h1-6,10,17H,7-9,11H2,(H,21,24,26) |
| InChIKey | ZHZQZEKYPHRRIU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|