C23H24N2O5S — CID 19706996
5-[[4-[2-(4-oxo-7-propan-2-yl-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 19706996) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 5-[[4-[2-(4-oxo-7-propan-2-yl-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(4-oxo-7-propan-2-yl-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 19706996 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 5-[[4-[2-(4-oxo-7-propan-2-yl-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)c1ccc2c(c1)OCN(CCOc1ccc(CC3SC(=O)NC3=O)cc1)C2=O |
| InChI | InChI=1S/C23H24N2O5S/c1-14(2)16-5-8-18-19(12-16)30-13-25(22(18)27)9-10-29-17-6-3-15(4-7-17)11-20-21(26)24-23(28)31-20/h3-8,12,14,20H,9-11,13H2,1-2H3,(H,24,26,28) |
| InChIKey | XKUJNGQWLJYIAY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|