C22H21N3O7S — CID 19707007
5-[[4-[4-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)butoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 19707007) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is 5-[[4-[4-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)butoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[4-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)butoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 19707007 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 5-[[4-[4-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)butoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCCCN3COc4ccc([N+](=O)[O-])cc4C3=O)cc2)S1 |
| InChI | InChI=1S/C22H21N3O7S/c26-20-19(33-22(28)23-20)11-14-3-6-16(7-4-14)31-10-2-1-9-24-13-32-18-8-5-15(25(29)30)12-17(18)21(24)27/h3-8,12,19H,1-2,9-11,13H2,(H,23,26,28) |
| InChIKey | MHGBKCCPESMXCS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|