C13H15NO — CID 19707352
2,4a,8a,9a,10,10a-hexahydro-1H-acridin-9-one (PubChem CID 19707352) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,4a,8a,9a,10,10a-hexahydro-1H-acridin-9-one.
| Compound Name | 2,4a,8a,9a,10,10a-hexahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 19707352 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,4a,8a,9a,10,10a-hexahydro-1H-acridin-9-one |
| SMILES | O=C1C2C=CC=CC2NC2C=CCCC12 |
| InChI | InChI=1S/C13H15NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1,3-5,7-12,14H,2,6H2 |
| InChIKey | FEJLDPLMCKKZAZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|