About S-(2-hydroxyoct-7-enyl) ethanethioate
S-(2-hydroxyoct-7-enyl) ethanethioate (PubChem CID 19707540) has the molecular formula C10H18O2S
and a molecular weight of 202.32 g/mol. Its IUPAC name is S-(2-hydroxyoct-7-enyl) ethanethioate.
Molecular Properties
| Compound Name | S-(2-hydroxyoct-7-enyl) ethanethioate |
| PubChem CID | 19707540 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | S-(2-hydroxyoct-7-enyl) ethanethioate |
| SMILES | C=CCCCCC(O)CSC(C)=O |
| InChI | InChI=1S/C10H18O2S/c1-3-4-5-6-7-10(12)8-13-9(2)11/h3,10,12H,1,4-8H2,2H3 |
| InChIKey | MUEASDBKFDNREW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-hydroxyoct-7-enyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-hydroxyoct-7-enyl) ethanethioate?
The IUPAC name of S-(2-hydroxyoct-7-enyl) ethanethioate (CID 19707540) is S-(2-hydroxyoct-7-enyl) ethanethioate.
What is the SMILES notation for S-(2-hydroxyoct-7-enyl) ethanethioate?
The canonical SMILES for S-(2-hydroxyoct-7-enyl) ethanethioate is C=CCCCCC(O)CSC(C)=O.
What is the InChIKey of S-(2-hydroxyoct-7-enyl) ethanethioate?
The InChIKey is MUEASDBKFDNREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2S/c1-3-4-5-6-7-10(12)8-13-9(2)11/h3,10,12H,1,4-8H2,2H3.
What are the key properties of S-(2-hydroxyoct-7-enyl) ethanethioate?
S-(2-hydroxyoct-7-enyl) ethanethioate has a molecular weight of 202.32 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-hydroxyoct-7-enyl) ethanethioate is sourced from PubChem (CID 19707540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).